C15H22N2O2 — CID 171287317
3-[(R)-cyclobutyl(piperazin-1-yl)methyl]benzene-1,2-diol (PubChem CID 171287317) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-[(R)-cyclobutyl(piperazin-1-yl)methyl]benzene-1,2-diol.
| Compound Name | 3-[(R)-cyclobutyl(piperazin-1-yl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 171287317 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-[(R)-cyclobutyl(piperazin-1-yl)methyl]benzene-1,2-diol |
| SMILES | Oc1cccc([C@@H](C2CCC2)N2CCNCC2)c1O |
| InChI | InChI=1S/C15H22N2O2/c18-13-6-2-5-12(15(13)19)14(11-3-1-4-11)17-9-7-16-8-10-17/h2,5-6,11,14,16,18-19H,1,3-4,7-10H2/t14-/m1/s1 |
| InChIKey | NDLPAQYVQUIRSJ-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|