C19H32Cl2N2 — CID 171275812
1-[(S)-cyclohexyl-(2,3-dimethylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171275812) has the molecular formula C19H32Cl2N2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(2,3-dimethylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-(2,3-dimethylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171275812 |
| Molecular Formula | C19H32Cl2N2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[(S)-cyclohexyl-(2,3-dimethylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1cccc([C@H](C2CCCCC2)N2CCNCC2)c1C.Cl.Cl |
| InChI | InChI=1S/C19H30N2.2ClH/c1-15-7-6-10-18(16(15)2)19(17-8-4-3-5-9-17)21-13-11-20-12-14-21;;/h6-7,10,17,19-20H,3-5,8-9,11-14H2,1-2H3;2*1H/t19-;;/m0../s1 |
| InChIKey | BYHHDWSHMXNYPD-TXEPZDRESA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |