C16H26Cl3N3 — CID 171273012
1-[(S)-(3-chloro-4-pyridinyl)-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171273012) has the molecular formula C16H26Cl3N3 and a molecular weight of 366.76 g/mol. Its IUPAC name is 1-[(S)-(3-chloro-4-pyridinyl)-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(3-chloro-4-pyridinyl)-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171273012 |
| Molecular Formula | C16H26Cl3N3 |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[(S)-(3-chloro-4-pyridinyl)-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cnccc1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H24ClN3.2ClH/c17-15-12-19-7-6-14(15)16(13-4-2-1-3-5-13)20-10-8-18-9-11-20;;/h6-7,12-13,16,18H,1-5,8-11H2;2*1H/t16-;;/m0../s1 |
| InChIKey | CHLGOIVJMGWEKL-SQKCAUCHSA-N |
| XLogP | 4.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |