C15H25Cl2N3 — CID 171287672
1-[(R)-cyclopentyl(pyridin-3-yl)methyl]piperazine;dihydrochloride (PubChem CID 171287672) has the molecular formula C15H25Cl2N3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl(pyridin-3-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopentyl(pyridin-3-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287672 |
| Molecular Formula | C15H25Cl2N3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[(R)-cyclopentyl(pyridin-3-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc([C@@H](C2CCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H23N3.2ClH/c1-2-5-13(4-1)15(14-6-3-7-17-12-14)18-10-8-16-9-11-18;;/h3,6-7,12-13,15-16H,1-2,4-5,8-11H2;2*1H/t15-;;/m1../s1 |
| InChIKey | PMGVTEPPIXXMNJ-QCUBGVIVSA-N |
| XLogP | 3.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |