C17H23F3N2S — CID 171165271
1-[(S)-cyclopentyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine (PubChem CID 171165271) has the molecular formula C17H23F3N2S and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171165271 |
| Molecular Formula | C17H23F3N2S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[(S)-cyclopentyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Sc1ccc([C@H](C2CCCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H23F3N2S/c18-17(19,20)23-15-7-5-14(6-8-15)16(13-3-1-2-4-13)22-11-9-21-10-12-22/h5-8,13,16,21H,1-4,9-12H2/t16-/m0/s1 |
| InChIKey | XZYDBPQWLDXRGN-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |