C13H18ClF3N2S — CID 171165322
1-[(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine;hydrochloride (PubChem CID 171165322) has the molecular formula C13H18ClF3N2S and a molecular weight of 326.82 g/mol. Its IUPAC name is 1-[(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171165322 |
| Molecular Formula | C13H18ClF3N2S |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-[(1S)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine;hydrochloride |
| SMILES | C[C@@H](c1ccc(SC(F)(F)F)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H17F3N2S.ClH/c1-10(18-8-6-17-7-9-18)11-2-4-12(5-3-11)19-13(14,15)16;/h2-5,10,17H,6-9H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | HSDAWIYLCCJWPK-PPHPATTJSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |