C13H16F4N2S — CID 171182558
1-[(1R)-2-fluoro-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine (PubChem CID 171182558) has the molecular formula C13H16F4N2S and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[(1R)-2-fluoro-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[(1R)-2-fluoro-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 171182558 |
| Molecular Formula | C13H16F4N2S |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[(1R)-2-fluoro-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]piperazine |
| SMILES | FC[C@@H](c1ccc(SC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C13H16F4N2S/c14-9-12(19-7-5-18-6-8-19)10-1-3-11(4-2-10)20-13(15,16)17/h1-4,12,18H,5-9H2/t12-/m0/s1 |
| InChIKey | HTZMBULZWNVWIB-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |