C15H21Cl2F3N2S — CID 171278996
1-[(S)-cyclopropyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171278996) has the molecular formula C15H21Cl2F3N2S and a molecular weight of 389.31 g/mol. Its IUPAC name is 1-[(S)-cyclopropyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopropyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278996 |
| Molecular Formula | C15H21Cl2F3N2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-[(S)-cyclopropyl-[4-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Sc1ccc([C@H](C2CC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H19F3N2S.2ClH/c16-15(17,18)21-13-5-3-12(4-6-13)14(11-1-2-11)20-9-7-19-8-10-20;;/h3-6,11,14,19H,1-2,7-10H2;2*1H/t14-;;/m0../s1 |
| InChIKey | IXAZFUVFMXHKMU-UTLKBRERSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |