C13H18ClF3N2OS — CID 171174552
(2R)-2-piperazin-1-yl-2-[4-(trifluoromethylsulfanyl)phenyl]ethanol;hydrochloride (PubChem CID 171174552) has the molecular formula C13H18ClF3N2OS and a molecular weight of 342.81 g/mol. Its IUPAC name is (2R)-2-piperazin-1-yl-2-[4-(trifluoromethylsulfanyl)phenyl]ethanol;hydrochloride.
| Compound Name | (2R)-2-piperazin-1-yl-2-[4-(trifluoromethylsulfanyl)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 171174552 |
| Molecular Formula | C13H18ClF3N2OS |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (2R)-2-piperazin-1-yl-2-[4-(trifluoromethylsulfanyl)phenyl]ethanol;hydrochloride |
| SMILES | Cl.OC[C@@H](c1ccc(SC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C13H17F3N2OS.ClH/c14-13(15,16)20-11-3-1-10(2-4-11)12(9-19)18-7-5-17-6-8-18;/h1-4,12,17,19H,5-9H2;1H/t12-;/m0./s1 |
| InChIKey | OVNQXRDQDZTMLN-YDALLXLXSA-N |
| XLogP | 2.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |