C17H25F3N2S — CID 171310237
1-[(1S)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine (PubChem CID 171310237) has the molecular formula C17H25F3N2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[(1S)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine.
| Compound Name | 1-[(1S)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine |
|---|---|
| PubChem CID | 171310237 |
| Molecular Formula | C17H25F3N2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(1S)-4-methyl-1-[4-(trifluoromethylsulfanyl)phenyl]pentyl]piperazine |
| SMILES | CC(C)CC[C@@H](c1ccc(SC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C17H25F3N2S/c1-13(2)3-8-16(22-11-9-21-10-12-22)14-4-6-15(7-5-14)23-17(18,19)20/h4-7,13,16,21H,3,8-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | REVNWNQPFPFPFM-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |