C13H19Cl2F3N2OS — CID 171299355
2-[(1S)-1-piperazin-1-ylethyl]-4-(trifluoromethylsulfanyl)phenol;dihydrochloride (PubChem CID 171299355) has the molecular formula C13H19Cl2F3N2OS and a molecular weight of 379.28 g/mol. Its IUPAC name is 2-[(1S)-1-piperazin-1-ylethyl]-4-(trifluoromethylsulfanyl)phenol;dihydrochloride.
| Compound Name | 2-[(1S)-1-piperazin-1-ylethyl]-4-(trifluoromethylsulfanyl)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299355 |
| Molecular Formula | C13H19Cl2F3N2OS |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[(1S)-1-piperazin-1-ylethyl]-4-(trifluoromethylsulfanyl)phenol;dihydrochloride |
| SMILES | C[C@@H](c1cc(SC(F)(F)F)ccc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H17F3N2OS.2ClH/c1-9(18-6-4-17-5-7-18)11-8-10(2-3-12(11)19)20-13(14,15)16;;/h2-3,8-9,17,19H,4-7H2,1H3;2*1H/t9-;;/m0../s1 |
| InChIKey | JWXULPGFDLNEIX-WWPIYYJJSA-N |
| XLogP | 3.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|