C13H22Cl2N2O — CID 171294351
5-methyl-2-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride (PubChem CID 171294351) has the molecular formula C13H22Cl2N2O and a molecular weight of 293.24 g/mol. Its IUPAC name is 5-methyl-2-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride.
| Compound Name | 5-methyl-2-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171294351 |
| Molecular Formula | C13H22Cl2N2O |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-methyl-2-[(1R)-1-piperazin-1-ylethyl]phenol;dihydrochloride |
| SMILES | Cc1ccc([C@@H](C)N2CCNCC2)c(O)c1.Cl.Cl |
| InChI | InChI=1S/C13H20N2O.2ClH/c1-10-3-4-12(13(16)9-10)11(2)15-7-5-14-6-8-15;;/h3-4,9,11,14,16H,5-8H2,1-2H3;2*1H/t11-;;/m1../s1 |
| InChIKey | QHOFUPWQASAHOH-NVJADKKVSA-N |
| XLogP | 2.51 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|