C19H23NO — CID 82965331
5-methyl-2-[1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]phenol (PubChem CID 82965331) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-methyl-2-[1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]phenol.
| Compound Name | 5-methyl-2-[1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]phenol |
|---|---|
| PubChem CID | 82965331 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-methyl-2-[1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]phenol |
| SMILES | Cc1ccc(C(C)N2CCc3ccccc3CC2)c(O)c1 |
| InChI | InChI=1S/C19H23NO/c1-14-7-8-18(19(21)13-14)15(2)20-11-9-16-5-3-4-6-17(16)10-12-20/h3-8,13,15,21H,9-12H2,1-2H3 |
| InChIKey | OGKQMVYLDBTQKJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|