C13H21BrCl2N2 — CID 171288103
1-[(1R)-1-(2-bromo-4-methylphenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171288103) has the molecular formula C13H21BrCl2N2 and a molecular weight of 356.14 g/mol. Its IUPAC name is 1-[(1R)-1-(2-bromo-4-methylphenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-bromo-4-methylphenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288103 |
| Molecular Formula | C13H21BrCl2N2 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1-[(1R)-1-(2-bromo-4-methylphenyl)ethyl]piperazine;dihydrochloride |
| SMILES | Cc1ccc([C@@H](C)N2CCNCC2)c(Br)c1.Cl.Cl |
| InChI | InChI=1S/C13H19BrN2.2ClH/c1-10-3-4-12(13(14)9-10)11(2)16-7-5-15-6-8-16;;/h3-4,9,11,15H,5-8H2,1-2H3;2*1H/t11-;;/m1../s1 |
| InChIKey | STTHYQPKOOULDQ-NVJADKKVSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |