C15H23BrN2 — CID 171275500
1-[(1S)-1-(2-bromo-4-methylphenyl)butyl]piperazine (PubChem CID 171275500) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromo-4-methylphenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-bromo-4-methylphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171275500 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(1S)-1-(2-bromo-4-methylphenyl)butyl]piperazine |
| SMILES | CCC[C@@H](c1ccc(C)cc1Br)N1CCNCC1 |
| InChI | InChI=1S/C15H23BrN2/c1-3-4-15(18-9-7-17-8-10-18)13-6-5-12(2)11-14(13)16/h5-6,11,15,17H,3-4,7-10H2,1-2H3/t15-/m0/s1 |
| InChIKey | GHRLRYDDPPKDOE-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |