C16H25BrN2 — CID 171288132
1-[(1R)-1-(2-bromo-4-methylphenyl)-3-methylbutyl]piperazine (PubChem CID 171288132) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-[(1R)-1-(2-bromo-4-methylphenyl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-bromo-4-methylphenyl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171288132 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[(1R)-1-(2-bromo-4-methylphenyl)-3-methylbutyl]piperazine |
| SMILES | Cc1ccc([C@@H](CC(C)C)N2CCNCC2)c(Br)c1 |
| InChI | InChI=1S/C16H25BrN2/c1-12(2)10-16(19-8-6-18-7-9-19)14-5-4-13(3)11-15(14)17/h4-5,11-12,16,18H,6-10H2,1-3H3/t16-/m1/s1 |
| InChIKey | NZICXNWICMEFDT-MRXNPFEDSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |