C15H22Br2N2O — CID 171272167
2,4-dibromo-6-[(1S)-3-methyl-1-piperazin-1-ylbutyl]phenol (PubChem CID 171272167) has the molecular formula C15H22Br2N2O and a molecular weight of 406.16 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1S)-3-methyl-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2,4-dibromo-6-[(1S)-3-methyl-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171272167 |
| Molecular Formula | C15H22Br2N2O |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2,4-dibromo-6-[(1S)-3-methyl-1-piperazin-1-ylbutyl]phenol |
| SMILES | CC(C)C[C@@H](c1cc(Br)cc(Br)c1O)N1CCNCC1 |
| InChI | InChI=1S/C15H22Br2N2O/c1-10(2)7-14(19-5-3-18-4-6-19)12-8-11(16)9-13(17)15(12)20/h8-10,14,18,20H,3-7H2,1-2H3/t14-/m0/s1 |
| InChIKey | DDFYVZVCWXSWLC-AWEZNQCLSA-N |
| XLogP | 3.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|