C16H25BrClFN2 — CID 171164572
1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-3-methylbutyl]piperazine;hydrochloride (PubChem CID 171164572) has the molecular formula C16H25BrClFN2 and a molecular weight of 379.75 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-3-methylbutyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-3-methylbutyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171164572 |
| Molecular Formula | C16H25BrClFN2 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-3-methylbutyl]piperazine;hydrochloride |
| SMILES | Cc1cc(Br)cc([C@H](CC(C)C)N2CCNCC2)c1F.Cl |
| InChI | InChI=1S/C16H24BrFN2.ClH/c1-11(2)8-15(20-6-4-19-5-7-20)14-10-13(17)9-12(3)16(14)18;/h9-11,15,19H,4-8H2,1-3H3;1H/t15-;/m0./s1 |
| InChIKey | ATTBQPVPFUUMDJ-RSAXXLAASA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |