C16H23BrClFN2 — CID 171164566
1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-2-cyclopropylethyl]piperazine;hydrochloride (PubChem CID 171164566) has the molecular formula C16H23BrClFN2 and a molecular weight of 377.73 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-2-cyclopropylethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-2-cyclopropylethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171164566 |
| Molecular Formula | C16H23BrClFN2 |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-[(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)-2-cyclopropylethyl]piperazine;hydrochloride |
| SMILES | Cc1cc(Br)cc([C@H](CC2CC2)N2CCNCC2)c1F.Cl |
| InChI | InChI=1S/C16H22BrFN2.ClH/c1-11-8-13(17)10-14(16(11)18)15(9-12-2-3-12)20-6-4-19-5-7-20;/h8,10,12,15,19H,2-7,9H2,1H3;1H/t15-;/m0./s1 |
| InChIKey | FAUZXTKZLDLWRE-RSAXXLAASA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |