C17H23ClF4N2O — CID 171176847
1-[(R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171176847) has the molecular formula C17H23ClF4N2O and a molecular weight of 382.83 g/mol. Its IUPAC name is 1-[(R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171176847 |
| Molecular Formula | C17H23ClF4N2O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[(R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)C(F)(F)Oc1ccccc1[C@@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H22F4N2O.ClH/c18-16(19)17(20,21)24-14-7-2-1-6-13(14)15(12-4-3-5-12)23-10-8-22-9-11-23;/h1-2,6-7,12,15-16,22H,3-5,8-11H2;1H/t15-;/m1./s1 |
| InChIKey | IPJTULIQIOFYAG-XFULWGLBSA-N |
| XLogP | 4.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|