C15H19Cl2F7N2O — CID 171303826
1-[(1R)-3,3,3-trifluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;dihydrochloride (PubChem CID 171303826) has the molecular formula C15H19Cl2F7N2O and a molecular weight of 447.22 g/mol. Its IUPAC name is 1-[(1R)-3,3,3-trifluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-3,3,3-trifluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303826 |
| Molecular Formula | C15H19Cl2F7N2O |
| Molecular Weight | 447.22 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-[(1R)-3,3,3-trifluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)C(F)(F)Oc1ccccc1[C@@H](CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C15H17F7N2O.2ClH/c16-13(17)15(21,22)25-12-4-2-1-3-10(12)11(9-14(18,19)20)24-7-5-23-6-8-24;;/h1-4,11,13,23H,5-9H2;2*1H/t11-;;/m1../s1 |
| InChIKey | QCMJRZPEMXGTGO-NVJADKKVSA-N |
| XLogP | 4.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|