C17H22F4N2O — CID 171279614
1-[(1S)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pent-4-enyl]piperazine (PubChem CID 171279614) has the molecular formula C17H22F4N2O and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-[(1S)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171279614 |
| Molecular Formula | C17H22F4N2O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(1S)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1ccccc1OC(F)(F)C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C17H22F4N2O/c1-2-3-7-14(23-11-9-22-10-12-23)13-6-4-5-8-15(13)24-17(20,21)16(18)19/h2,4-6,8,14,16,22H,1,3,7,9-12H2/t14-/m0/s1 |
| InChIKey | XEMWVDBOOKBPOE-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|