C16H22BrCl2F3N2O — CID 171279399
1-[(1S)-1-[5-bromo-2-(trifluoromethoxy)phenyl]pent-4-enyl]piperazine;dihydrochloride (PubChem CID 171279399) has the molecular formula C16H22BrCl2F3N2O and a molecular weight of 466.17 g/mol. Its IUPAC name is 1-[(1S)-1-[5-bromo-2-(trifluoromethoxy)phenyl]pent-4-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-[5-bromo-2-(trifluoromethoxy)phenyl]pent-4-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279399 |
| Molecular Formula | C16H22BrCl2F3N2O |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 1-[(1S)-1-[5-bromo-2-(trifluoromethoxy)phenyl]pent-4-enyl]piperazine;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cc(Br)ccc1OC(F)(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H20BrF3N2O.2ClH/c1-2-3-4-14(22-9-7-21-8-10-22)13-11-12(17)5-6-15(13)23-16(18,19)20;;/h2,5-6,11,14,21H,1,3-4,7-10H2;2*1H/t14-;;/m0../s1 |
| InChIKey | HQDGQIZSQGQWJA-UTLKBRERSA-N |
| XLogP | 5.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|