C15H23BrCl2N2O — CID 171272892
4-bromo-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride (PubChem CID 171272892) has the molecular formula C15H23BrCl2N2O and a molecular weight of 398.17 g/mol. Its IUPAC name is 4-bromo-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride.
| Compound Name | 4-bromo-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171272892 |
| Molecular Formula | C15H23BrCl2N2O |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-bromo-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cc(Br)ccc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H21BrN2O.2ClH/c1-2-3-4-14(18-9-7-17-8-10-18)13-11-12(16)5-6-15(13)19;;/h2,5-6,11,14,17,19H,1,3-4,7-10H2;2*1H/t14-;;/m0../s1 |
| InChIKey | DRZRIPVEQYAOQR-UTLKBRERSA-N |
| XLogP | 3.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|