C18H27ClF4N2O — CID 171171145
1-[(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexyl]piperazine;hydrochloride (PubChem CID 171171145) has the molecular formula C18H27ClF4N2O and a molecular weight of 398.87 g/mol. Its IUPAC name is 1-[(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171145 |
| Molecular Formula | C18H27ClF4N2O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexyl]piperazine;hydrochloride |
| SMILES | CCCCC[C@H](c1ccccc1OC(F)(F)C(F)F)N1CCNCC1.Cl |
| InChI | InChI=1S/C18H26F4N2O.ClH/c1-2-3-4-8-15(24-12-10-23-11-13-24)14-7-5-6-9-16(14)25-18(21,22)17(19)20;/h5-7,9,15,17,23H,2-4,8,10-13H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | DRILIARYBYHMKA-XFULWGLBSA-N |
| XLogP | 4.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|