C18H28Cl2F4N2O — CID 171310278
1-[(1S)-4-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]piperazine;dihydrochloride (PubChem CID 171310278) has the molecular formula C18H28Cl2F4N2O and a molecular weight of 435.33 g/mol. Its IUPAC name is 1-[(1S)-4-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-4-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171310278 |
| Molecular Formula | C18H28Cl2F4N2O |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[(1S)-4-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentyl]piperazine;dihydrochloride |
| SMILES | CC(C)CC[C@@H](c1ccccc1OC(F)(F)C(F)F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H26F4N2O.2ClH/c1-13(2)7-8-15(24-11-9-23-10-12-24)14-5-3-4-6-16(14)25-18(21,22)17(19)20;;/h3-6,13,15,17,23H,7-12H2,1-2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | QLOHJTRJIBUQCC-CKUXDGONSA-N |
| XLogP | 5.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|