C18H30N2O — CID 171310795
1-[(1R)-1-(2-ethoxyphenyl)-4-methylpentyl]piperazine (PubChem CID 171310795) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-[(1R)-1-(2-ethoxyphenyl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-ethoxyphenyl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171310795 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-[(1R)-1-(2-ethoxyphenyl)-4-methylpentyl]piperazine |
| SMILES | CCOc1ccccc1[C@@H](CCC(C)C)N1CCNCC1 |
| InChI | InChI=1S/C18H30N2O/c1-4-21-18-8-6-5-7-16(18)17(10-9-15(2)3)20-13-11-19-12-14-20/h5-8,15,17,19H,4,9-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | LOGVHLNEDZMOTE-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |