C15H26Cl2N2O — CID 171288177
1-[(1R)-1-(2-ethoxyphenyl)propyl]piperazine;dihydrochloride (PubChem CID 171288177) has the molecular formula C15H26Cl2N2O and a molecular weight of 321.29 g/mol. Its IUPAC name is 1-[(1R)-1-(2-ethoxyphenyl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-ethoxyphenyl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288177 |
| Molecular Formula | C15H26Cl2N2O |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[(1R)-1-(2-ethoxyphenyl)propyl]piperazine;dihydrochloride |
| SMILES | CCOc1ccccc1[C@@H](CC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H24N2O.2ClH/c1-3-14(17-11-9-16-10-12-17)13-7-5-6-8-15(13)18-4-2;;/h5-8,14,16H,3-4,9-12H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | JQIFCWNFWYCAJY-FMOMHUKBSA-N |
| XLogP | 3.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |