C14H20F2N2O — CID 171288181
1-[(1S)-1-(2-ethoxyphenyl)-2,2-difluoroethyl]piperazine (PubChem CID 171288181) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-[(1S)-1-(2-ethoxyphenyl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-ethoxyphenyl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 171288181 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[(1S)-1-(2-ethoxyphenyl)-2,2-difluoroethyl]piperazine |
| SMILES | CCOc1ccccc1[C@@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H20F2N2O/c1-2-19-12-6-4-3-5-11(12)13(14(15)16)18-9-7-17-8-10-18/h3-6,13-14,17H,2,7-10H2,1H3/t13-/m0/s1 |
| InChIKey | VMVYFPRTNSRZIJ-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |