C21H30Cl2N2O — CID 171295565
1-[(1R)-1-(2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171295565) has the molecular formula C21H30Cl2N2O and a molecular weight of 397.39 g/mol. Its IUPAC name is 1-[(1R)-1-(2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295565 |
| Molecular Formula | C21H30Cl2N2O |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[(1R)-1-(2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccccc1OCc1ccccc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H28N2O.2ClH/c1-2-8-20(23-15-13-22-14-16-23)19-11-6-7-12-21(19)24-17-18-9-4-3-5-10-18;;/h3-7,9-12,20,22H,2,8,13-17H2,1H3;2*1H/t20-;;/m1../s1 |
| InChIKey | NGTGPDKXTFPVAP-FAVHNTAZSA-N |
| XLogP | 4.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |