C23H32N2O — CID 171283020
1-[(1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)butyl]piperazine (PubChem CID 171283020) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171283020 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-[(1S)-1-(3,5-dimethyl-4-phenylmethoxyphenyl)butyl]piperazine |
| SMILES | CCC[C@@H](c1cc(C)c(OCc2ccccc2)c(C)c1)N1CCNCC1 |
| InChI | InChI=1S/C23H32N2O/c1-4-8-22(25-13-11-24-12-14-25)21-15-18(2)23(19(3)16-21)26-17-20-9-6-5-7-10-20/h5-7,9-10,15-16,22,24H,4,8,11-14,17H2,1-3H3/t22-/m0/s1 |
| InChIKey | RVSBVDODVQPBCC-QFIPXVFZSA-N |
| XLogP | 4.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |