C25H34N2O2 — CID 171283016
1-[(S)-(3,5-dimethyl-4-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171283016) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[(S)-(3,5-dimethyl-4-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(S)-(3,5-dimethyl-4-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171283016 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[(S)-(3,5-dimethyl-4-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | Cc1cc([C@H](C2CCOCC2)N2CCNCC2)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H34N2O2/c1-19-16-23(17-20(2)25(19)29-18-21-6-4-3-5-7-21)24(22-8-14-28-15-9-22)27-12-10-26-11-13-27/h3-7,16-17,22,24,26H,8-15,18H2,1-2H3/t24-/m0/s1 |
| InChIKey | CXKDHDNPXLXVJF-DEOSSOPVSA-N |
| XLogP | 4.26 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |