C26H36N2O — CID 171283012
1-[(S)-cyclohexyl-(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]piperazine (PubChem CID 171283012) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(S)-cyclohexyl-(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171283012 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 1-[(S)-cyclohexyl-(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]piperazine |
| SMILES | Cc1cc([C@H](C2CCCCC2)N2CCNCC2)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O/c1-20-17-24(18-21(2)26(20)29-19-22-9-5-3-6-10-22)25(23-11-7-4-8-12-23)28-15-13-27-14-16-28/h3,5-6,9-10,17-18,23,25,27H,4,7-8,11-16,19H2,1-2H3/t25-/m0/s1 |
| InChIKey | PRKZHFIQTLZNIA-VWLOTQADSA-N |
| XLogP | 5.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |