C24H34Cl2N2O3 — CID 171294768
1-[(R)-(4-methoxy-3-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171294768) has the molecular formula C24H34Cl2N2O3 and a molecular weight of 469.45 g/mol. Its IUPAC name is 1-[(R)-(4-methoxy-3-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(4-methoxy-3-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294768 |
| Molecular Formula | C24H34Cl2N2O3 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1-[(R)-(4-methoxy-3-phenylmethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@@H](C2CCOCC2)N2CCNCC2)cc1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C24H32N2O3.2ClH/c1-27-22-8-7-21(17-23(22)29-18-19-5-3-2-4-6-19)24(20-9-15-28-16-10-20)26-13-11-25-12-14-26;;/h2-8,17,20,24-25H,9-16,18H2,1H3;2*1H/t24-;;/m1../s1 |
| InChIKey | XFKSLWGGIVDXKD-PPLJNSMQSA-N |
| XLogP | 4.49 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |