C24H34N2O3 — CID 5150431
1-[1-(3,5-dimethoxy-4-phenylmethoxyphenyl)pentyl]piperazine (PubChem CID 5150431) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxy-4-phenylmethoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[1-(3,5-dimethoxy-4-phenylmethoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 5150431 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-[1-(3,5-dimethoxy-4-phenylmethoxyphenyl)pentyl]piperazine |
| SMILES | CCCCC(c1cc(OC)c(OCc2ccccc2)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C24H34N2O3/c1-4-5-11-21(26-14-12-25-13-15-26)20-16-22(27-2)24(23(17-20)28-3)29-18-19-9-7-6-8-10-19/h6-10,16-17,21,25H,4-5,11-15,18H2,1-3H3 |
| InChIKey | PJAYKUCXHWGDIW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |