C27H32N2O4 — CID 4594062
1-[(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-methoxyphenyl)methyl]piperazine (PubChem CID 4594062) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 1-[(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4594062 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[(3,5-dimethoxy-4-phenylmethoxyphenyl)-(2-methoxyphenyl)methyl]piperazine |
| SMILES | COc1ccccc1C(c1cc(OC)c(OCc2ccccc2)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C27H32N2O4/c1-30-23-12-8-7-11-22(23)26(29-15-13-28-14-16-29)21-17-24(31-2)27(25(18-21)32-3)33-19-20-9-5-4-6-10-20/h4-12,17-18,26,28H,13-16,19H2,1-3H3 |
| InChIKey | HFYHPDXGEINNHM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |