C20H26N2O3 — CID 7016984
1-[(R)-phenyl-(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 7016984) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(R)-phenyl-(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(R)-phenyl-(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 7016984 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(R)-phenyl-(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc([C@@H](c2ccccc2)N2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N2O3/c1-23-17-13-16(14-18(24-2)20(17)25-3)19(15-7-5-4-6-8-15)22-11-9-21-10-12-22/h4-8,13-14,19,21H,9-12H2,1-3H3/t19-/m1/s1 |
| InChIKey | AEBSPPODFOQFNP-LJQANCHMSA-N |
| XLogP | 2.71 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |