C20H27N3O3 — CID 3356255
1-[pyridin-4-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3356255) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[pyridin-4-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[pyridin-4-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3356255 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[pyridin-4-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cc(C(c2ccncc2)N2CCCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H27N3O3/c1-24-17-13-16(14-18(25-2)20(17)26-3)19(15-5-8-22-9-6-15)23-11-4-7-21-10-12-23/h5-6,8-9,13-14,19,21H,4,7,10-12H2,1-3H3 |
| InChIKey | QYEGDTMRKFLNLS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |