C19H26N2O4 — CID 4594908
1-[furan-2-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 4594908) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[furan-2-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[furan-2-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 4594908 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[furan-2-yl-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1cc(C(c2ccco2)N2CCCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N2O4/c1-22-16-12-14(13-17(23-2)19(16)24-3)18(15-6-4-11-25-15)21-9-5-7-20-8-10-21/h4,6,11-13,18,20H,5,7-10H2,1-3H3 |
| InChIKey | ZYWWGHJVPFGVOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |