C20H27N3O3 — CID 3477056
1-[(3-methyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 3477056) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[(3-methyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3-methyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3477056 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[(3-methyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(C(c2ncccc2C)N2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H27N3O3/c1-14-6-5-7-22-18(14)19(23-10-8-21-9-11-23)15-12-16(24-2)20(26-4)17(13-15)25-3/h5-7,12-13,19,21H,8-11H2,1-4H3 |
| InChIKey | BTOJKSVBIKRBHM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |