C22H31N3O3 — CID 3783871
1-[(5-ethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3783871) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[(5-ethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-ethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3783871 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[(5-ethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | CCc1ccc(C(c2cc(OC)c(OC)c(OC)c2)N2CCCNCC2)nc1 |
| InChI | InChI=1S/C22H31N3O3/c1-5-16-7-8-18(24-15-16)21(25-11-6-9-23-10-12-25)17-13-19(26-2)22(28-4)20(14-17)27-3/h7-8,13-15,21,23H,5-6,9-12H2,1-4H3 |
| InChIKey | ZBCYIRZZXDAOHS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |