C20H27N3O — CID 3732221
1-[(3-ethoxyphenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane (PubChem CID 3732221) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[(3-ethoxyphenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3-ethoxyphenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3732221 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[(3-ethoxyphenyl)-(5-methyl-2-pyridinyl)methyl]-1,4-diazepane |
| SMILES | CCOc1cccc(C(c2ccc(C)cn2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C20H27N3O/c1-3-24-18-7-4-6-17(14-18)20(19-9-8-16(2)15-22-19)23-12-5-10-21-11-13-23/h4,6-9,14-15,20-21H,3,5,10-13H2,1-2H3 |
| InChIKey | XSNWQVSHDQLKBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |