C21H26N2O3 — CID 3832556
1-[1,3-benzodioxol-5-yl-(3-ethoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3832556) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-(3-ethoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[1,3-benzodioxol-5-yl-(3-ethoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3832556 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-(3-ethoxyphenyl)methyl]-1,4-diazepane |
| SMILES | CCOc1cccc(C(c2ccc3c(c2)OCO3)N2CCCNCC2)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-2-24-18-6-3-5-16(13-18)21(23-11-4-9-22-10-12-23)17-7-8-19-20(14-17)26-15-25-19/h3,5-8,13-14,21-22H,2,4,9-12,15H2,1H3 |
| InChIKey | HQQYMTMONFUJBT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |