C20H24N2O3 — CID 3927305
1-[1,3-benzodioxol-5-yl-(4-ethoxyphenyl)methyl]piperazine (PubChem CID 3927305) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-(4-ethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[1,3-benzodioxol-5-yl-(4-ethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3927305 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-(4-ethoxyphenyl)methyl]piperazine |
| SMILES | CCOc1ccc(C(c2ccc3c(c2)OCO3)N2CCNCC2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-23-17-6-3-15(4-7-17)20(22-11-9-21-10-12-22)16-5-8-18-19(13-16)25-14-24-18/h3-8,13,20-21H,2,9-12,14H2,1H3 |
| InChIKey | SHBFTHNWYCQTMO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |