C17H24Cl2N2OS — CID 171287098
1-[(S)-(4-ethoxyphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171287098) has the molecular formula C17H24Cl2N2OS and a molecular weight of 375.37 g/mol. Its IUPAC name is 1-[(S)-(4-ethoxyphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(4-ethoxyphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287098 |
| Molecular Formula | C17H24Cl2N2OS |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[(S)-(4-ethoxyphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | CCOc1ccc([C@@H](c2cccs2)N2CCNCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22N2OS.2ClH/c1-2-20-15-7-5-14(6-8-15)17(16-4-3-13-21-16)19-11-9-18-10-12-19;;/h3-8,13,17-18H,2,9-12H2,1H3;2*1H/t17-;;/m0../s1 |
| InChIKey | XEXKAORKEFMCRJ-RMRYJAPISA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |