C17H24Cl2N2O2S — CID 171287197
2-ethoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride (PubChem CID 171287197) has the molecular formula C17H24Cl2N2O2S and a molecular weight of 391.36 g/mol. Its IUPAC name is 2-ethoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride.
| Compound Name | 2-ethoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171287197 |
| Molecular Formula | C17H24Cl2N2O2S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-ethoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
| SMILES | CCOc1cc([C@@H](c2cccs2)N2CCNCC2)ccc1O.Cl.Cl |
| InChI | InChI=1S/C17H22N2O2S.2ClH/c1-2-21-15-12-13(5-6-14(15)20)17(16-4-3-11-22-16)19-9-7-18-8-10-19;;/h3-6,11-12,17-18,20H,2,7-10H2,1H3;2*1H/t17-;;/m0../s1 |
| InChIKey | DPUVMBCDBFRPDS-RMRYJAPISA-N |
| XLogP | 3.69 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |