C16H21Cl3N2O2S — CID 171296198
2-chloro-6-methoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride (PubChem CID 171296198) has the molecular formula C16H21Cl3N2O2S and a molecular weight of 411.78 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride.
| Compound Name | 2-chloro-6-methoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171296198 |
| Molecular Formula | C16H21Cl3N2O2S |
| Molecular Weight | 411.78 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-chloro-6-methoxy-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
| SMILES | COc1cc([C@@H](c2cccs2)N2CCNCC2)cc(Cl)c1O.Cl.Cl |
| InChI | InChI=1S/C16H19ClN2O2S.2ClH/c1-21-13-10-11(9-12(17)16(13)20)15(14-3-2-8-22-14)19-6-4-18-5-7-19;;/h2-3,8-10,15,18,20H,4-7H2,1H3;2*1H/t15-;;/m0../s1 |
| InChIKey | DWLOOGKXUBYSLP-CKUXDGONSA-N |
| XLogP | 3.95 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |