C16H19BrN2O2S — CID 171282069
4-bromo-2-methoxy-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171282069) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171282069 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 4-bromo-2-methoxy-6-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | COc1cc(Br)cc([C@H](c2cccs2)N2CCNCC2)c1O |
| InChI | InChI=1S/C16H19BrN2O2S/c1-21-13-10-11(17)9-12(16(13)20)15(14-3-2-8-22-14)19-6-4-18-5-7-19/h2-3,8-10,15,18,20H,4-7H2,1H3/t15-/m1/s1 |
| InChIKey | VZGKFZKEFLIAGX-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|