C19H28Cl2N2OS — CID 171284248
1-[(R)-(2-methoxy-5-propan-2-ylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171284248) has the molecular formula C19H28Cl2N2OS and a molecular weight of 403.42 g/mol. Its IUPAC name is 1-[(R)-(2-methoxy-5-propan-2-ylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(2-methoxy-5-propan-2-ylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284248 |
| Molecular Formula | C19H28Cl2N2OS |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[(R)-(2-methoxy-5-propan-2-ylphenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(C(C)C)cc1[C@H](c1cccs1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H26N2OS.2ClH/c1-14(2)15-6-7-17(22-3)16(13-15)19(18-5-4-12-23-18)21-10-8-20-9-11-21;;/h4-7,12-14,19-20H,8-11H2,1-3H3;2*1H/t19-;;/m1../s1 |
| InChIKey | WPHAVUSYNHNZTJ-JQDLGSOUSA-N |
| XLogP | 4.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |