C18H24N2O2S — CID 171296575
1-[(S)-(2,6-dimethoxy-4-methylphenyl)-thiophen-2-ylmethyl]piperazine (PubChem CID 171296575) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[(S)-(2,6-dimethoxy-4-methylphenyl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(S)-(2,6-dimethoxy-4-methylphenyl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171296575 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-[(S)-(2,6-dimethoxy-4-methylphenyl)-thiophen-2-ylmethyl]piperazine |
| SMILES | COc1cc(C)cc(OC)c1[C@@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C18H24N2O2S/c1-13-11-14(21-2)17(15(12-13)22-3)18(16-5-4-10-23-16)20-8-6-19-7-9-20/h4-5,10-12,18-19H,6-9H2,1-3H3/t18-/m1/s1 |
| InChIKey | UYHIKYQJNAPUKZ-GOSISDBHSA-N |
| XLogP | 3.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |